C16H34N2OSi — CID 154409844
bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane (PubChem CID 154409844) has the molecular formula C16H34N2OSi and a molecular weight of 298.55 g/mol. Its IUPAC name is bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane.
| Compound Name | bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane |
|---|---|
| PubChem CID | 154409844 |
| Molecular Formula | C16H34N2OSi |
| Molecular Weight | 298.55 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane |
| SMILES | C[C@@H]1CCC[C@H](C)N1C(OC[SiH3])N1[C@H](C)CCC[C@@H]1C |
| InChI | InChI=1S/C16H34N2OSi/c1-12-7-5-8-13(2)17(12)16(19-11-20)18-14(3)9-6-10-15(18)4/h12-16H,5-11H2,1-4,20H3/t12-,13+,14-,15+ |
| InChIKey | IVHRKUONDQCHPO-NMWPEEMBSA-N |
| XLogP | 2.14 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.55 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|