About bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane
bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane (PubChem CID 154409844) has the molecular formula C16H34N2OSi
and a molecular weight of 298.55 g/mol. Its IUPAC name is bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane.
Molecular Properties
| Compound Name | bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane |
| PubChem CID | 154409844 |
| Molecular Formula | C16H34N2OSi |
| Molecular Weight | 298.55 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane |
| SMILES | C[C@@H]1CCC[C@H](C)N1C(OC[SiH3])N1[C@H](C)CCC[C@@H]1C |
| InChI | InChI=1S/C16H34N2OSi/c1-12-7-5-8-13(2)17(12)16(19-11-20)18-14(3)9-6-10-15(18)4/h12-16H,5-11H2,1-4,20H3/t12-,13+,14-,15+ |
| InChIKey | IVHRKUONDQCHPO-NMWPEEMBSA-N |
| XLogP | 2.14 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.55 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane?
The IUPAC name of bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane (CID 154409844) is bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane.
What is the SMILES notation for bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane?
The canonical SMILES for bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane is C[C@@H]1CCC[C@H](C)N1C(OC[SiH3])N1[C@H](C)CCC[C@@H]1C.
What is the InChIKey of bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane?
The InChIKey is IVHRKUONDQCHPO-NMWPEEMBSA-N. The full InChI is InChI=1S/C16H34N2OSi/c1-12-7-5-8-13(2)17(12)16(19-11-20)18-14(3)9-6-10-15(18)4/h12-16H,5-11H2,1-4,20H3/t12-,13+,14-,15+.
What are the key properties of bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane?
bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane has a molecular weight of 298.55 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(2S,6R)-2,6-dimethylpiperidin-1-yl]methoxymethylsilane is sourced from PubChem (CID 154409844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).