C9H23NSi2 — CID 123780865
(2,6-dimethylpiperidin-1-yl)-(2-silylethyl)silane (PubChem CID 123780865) has the molecular formula C9H23NSi2 and a molecular weight of 201.46 g/mol. Its IUPAC name is (2,6-dimethylpiperidin-1-yl)-(2-silylethyl)silane.
| Compound Name | (2,6-dimethylpiperidin-1-yl)-(2-silylethyl)silane |
|---|---|
| PubChem CID | 123780865 |
| Molecular Formula | C9H23NSi2 |
| Molecular Weight | 201.46 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (2,6-dimethylpiperidin-1-yl)-(2-silylethyl)silane |
| SMILES | CC1CCCC(C)N1[SiH2]CC[SiH3] |
| InChI | InChI=1S/C9H23NSi2/c1-8-4-3-5-9(2)10(8)12-7-6-11/h8-9H,3-7,12H2,1-2,11H3 |
| InChIKey | GXRMJKLMLFLCMQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.46 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|