C9H20BN — CID 169243459
(2,6-dimethylpiperidin-1-yl)-dimethylborane (PubChem CID 169243459) has the molecular formula C9H20BN and a molecular weight of 153.08 g/mol. Its IUPAC name is (2,6-dimethylpiperidin-1-yl)-dimethylborane.
| Compound Name | (2,6-dimethylpiperidin-1-yl)-dimethylborane |
|---|---|
| PubChem CID | 169243459 |
| Molecular Formula | C9H20BN |
| Molecular Weight | 153.08 g/mol |
| Exact Mass | 153.17 |
| IUPAC Name | (2,6-dimethylpiperidin-1-yl)-dimethylborane |
| SMILES | CB(C)N1C(C)CCCC1C |
| InChI | InChI=1S/C9H20BN/c1-8-6-5-7-9(2)11(8)10(3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | AXEJDUAQHKICSI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.08 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|