C12H23NO2 — CID 142269040
1-(2-acetyl-5-methylpyrrolidin-1-yl)propan-1-one;ethane (PubChem CID 142269040) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-(2-acetyl-5-methylpyrrolidin-1-yl)propan-1-one;ethane.
| Compound Name | 1-(2-acetyl-5-methylpyrrolidin-1-yl)propan-1-one;ethane |
|---|---|
| PubChem CID | 142269040 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 1-(2-acetyl-5-methylpyrrolidin-1-yl)propan-1-one;ethane |
| SMILES | CC.CCC(=O)N1C(C)CCC1C(C)=O |
| InChI | InChI=1S/C10H17NO2.C2H6/c1-4-10(13)11-7(2)5-6-9(11)8(3)12;1-2/h7,9H,4-6H2,1-3H3;1-2H3 |
| InChIKey | AFKJGXNIVFPEBY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |