C13H24N2O — CID 91030343
bis(2,5-dimethylpyrrolidin-1-yl)methanone (PubChem CID 91030343) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is bis(2,5-dimethylpyrrolidin-1-yl)methanone.
| Compound Name | bis(2,5-dimethylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 91030343 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | bis(2,5-dimethylpyrrolidin-1-yl)methanone |
| SMILES | CC1CCC(C)N1C(=O)N1C(C)CCC1C |
| InChI | InChI=1S/C13H24N2O/c1-9-5-6-10(2)14(9)13(16)15-11(3)7-8-12(15)4/h9-12H,5-8H2,1-4H3 |
| InChIKey | MLVNWBVYKQSWQI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |