C13H29NO — CID 156753838
1-(2,5-dimethylpiperidin-1-yl)ethanone;ethane (PubChem CID 156753838) has the molecular formula C13H29NO and a molecular weight of 215.38 g/mol. Its IUPAC name is 1-(2,5-dimethylpiperidin-1-yl)ethanone;ethane.
| Compound Name | 1-(2,5-dimethylpiperidin-1-yl)ethanone;ethane |
|---|---|
| PubChem CID | 156753838 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | 1-(2,5-dimethylpiperidin-1-yl)ethanone;ethane |
| SMILES | CC.CC.CC(=O)N1CC(C)CCC1C |
| InChI | InChI=1S/C9H17NO.2C2H6/c1-7-4-5-8(2)10(6-7)9(3)11;2*1-2/h7-8H,4-6H2,1-3H3;2*1-2H3 |
| InChIKey | SHGDSHGZKWVGRH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |