C11H17NO — CID 131067309
1-(2,5-dimethylpiperidin-1-yl)but-2-yn-1-one (PubChem CID 131067309) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-(2,5-dimethylpiperidin-1-yl)but-2-yn-1-one.
| Compound Name | 1-(2,5-dimethylpiperidin-1-yl)but-2-yn-1-one |
|---|---|
| PubChem CID | 131067309 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1-(2,5-dimethylpiperidin-1-yl)but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CC(C)CCC1C |
| InChI | InChI=1S/C11H17NO/c1-4-5-11(13)12-8-9(2)6-7-10(12)3/h9-10H,6-8H2,1-3H3 |
| InChIKey | ZEPAHIRTFPSQBX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|