C12H23NO — CID 161369093
1-[(2S,5R)-2,5-dimethylpiperidin-1-yl]prop-2-en-1-one;ethane (PubChem CID 161369093) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 1-[(2S,5R)-2,5-dimethylpiperidin-1-yl]prop-2-en-1-one;ethane.
| Compound Name | 1-[(2S,5R)-2,5-dimethylpiperidin-1-yl]prop-2-en-1-one;ethane |
|---|---|
| PubChem CID | 161369093 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 1-[(2S,5R)-2,5-dimethylpiperidin-1-yl]prop-2-en-1-one;ethane |
| SMILES | C=CC(=O)N1C[C@H](C)CC[C@@H]1C.CC |
| InChI | InChI=1S/C10H17NO.C2H6/c1-4-10(12)11-7-8(2)5-6-9(11)3;1-2/h4,8-9H,1,5-7H2,2-3H3;1-2H3/t8-,9+;/m1./s1 |
| InChIKey | VQFLSTNMWHJCNJ-RJUBDTSPSA-N |
| XLogP | 2.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|