C15H27NO — CID 176827739
1-[2-methyl-4,5-di(propan-2-yl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 176827739) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 1-[2-methyl-4,5-di(propan-2-yl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[2-methyl-4,5-di(propan-2-yl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 176827739 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 1-[2-methyl-4,5-di(propan-2-yl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(C(C)C)C(C(C)C)CC1C |
| InChI | InChI=1S/C15H27NO/c1-7-15(17)16-9-14(11(4)5)13(10(2)3)8-12(16)6/h7,10-14H,1,8-9H2,2-6H3 |
| InChIKey | YKFJIRFNCRXMRV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|