C15H28N2O — CID 176827753
1-[2,6-dimethyl-3,4-di(propan-2-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 176827753) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 1-[2,6-dimethyl-3,4-di(propan-2-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[2,6-dimethyl-3,4-di(propan-2-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 176827753 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 1-[2,6-dimethyl-3,4-di(propan-2-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C(C)CN(C(C)C)C(C(C)C)C1C |
| InChI | InChI=1S/C15H28N2O/c1-8-14(18)17-12(6)9-16(11(4)5)15(10(2)3)13(17)7/h8,10-13,15H,1,9H2,2-7H3 |
| InChIKey | LPEOXRURTYTPSC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|