C14H25NO — CID 145040393
cyclohexyl-[(2R,5S)-2,5-dimethylpiperidin-1-yl]methanone (PubChem CID 145040393) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is cyclohexyl-[(2R,5S)-2,5-dimethylpiperidin-1-yl]methanone.
| Compound Name | cyclohexyl-[(2R,5S)-2,5-dimethylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 145040393 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | cyclohexyl-[(2R,5S)-2,5-dimethylpiperidin-1-yl]methanone |
| SMILES | C[C@H]1CC[C@@H](C)N(C(=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C14H25NO/c1-11-8-9-12(2)15(10-11)14(16)13-6-4-3-5-7-13/h11-13H,3-10H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | KVUZDOKSJBPTNX-NWDGAFQWSA-N |
| XLogP | 3.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |