C16H24N2O2 — CID 102005518
(1R,2R,6S,7S)-3-acetyl-1,7,8,9,10,10-hexamethyl-3,5-diazatricyclo[5.2.1.02,6]dec-8-en-4-one (PubChem CID 102005518) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (1R,2R,6S,7S)-3-acetyl-1,7,8,9,10,10-hexamethyl-3,5-diazatricyclo[5.2.1.02,6]dec-8-en-4-one.
| Compound Name | (1R,2R,6S,7S)-3-acetyl-1,7,8,9,10,10-hexamethyl-3,5-diazatricyclo[5.2.1.02,6]dec-8-en-4-one |
|---|---|
| PubChem CID | 102005518 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (1R,2R,6S,7S)-3-acetyl-1,7,8,9,10,10-hexamethyl-3,5-diazatricyclo[5.2.1.02,6]dec-8-en-4-one |
| SMILES | CC(=O)N1C(=O)N[C@@H]2[C@H]1[C@]1(C)C(C)=C(C)[C@@]2(C)C1(C)C |
| InChI | InChI=1S/C16H24N2O2/c1-8-9(2)16(7)12-11(15(8,6)14(16,4)5)17-13(20)18(12)10(3)19/h11-12H,1-7H3,(H,17,20)/t11-,12+,15-,16+/m1/s1 |
| InChIKey | OFTFCNYUDPIJGI-KOZAUXTDSA-N |
| XLogP | 2.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|