C10H15N — CID 123362281
N-methyl-1,2,3,3a,4,7a-hexahydroinden-5-imine (PubChem CID 123362281) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is N-methyl-1,2,3,3a,4,7a-hexahydroinden-5-imine.
| Compound Name | N-methyl-1,2,3,3a,4,7a-hexahydroinden-5-imine |
|---|---|
| PubChem CID | 123362281 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | N-methyl-1,2,3,3a,4,7a-hexahydroinden-5-imine |
| SMILES | C/N=C1\C=CC2CCCC2C1 |
| InChI | InChI=1S/C10H15N/c1-11-10-6-5-8-3-2-4-9(8)7-10/h5-6,8-9H,2-4,7H2,1H3/b11-10+ |
| InChIKey | SOUCTSSMKBRWFH-ZHACJKMWSA-N |
| XLogP | 2.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|