C9H13NO — CID 130979837
(3aS,6aR)-1,3a,4,5,6,6a-hexahydropentalene-2-carboxamide (PubChem CID 130979837) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (3aS,6aR)-1,3a,4,5,6,6a-hexahydropentalene-2-carboxamide.
| Compound Name | (3aS,6aR)-1,3a,4,5,6,6a-hexahydropentalene-2-carboxamide |
|---|---|
| PubChem CID | 130979837 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (3aS,6aR)-1,3a,4,5,6,6a-hexahydropentalene-2-carboxamide |
| SMILES | NC(=O)C1=C[C@H]2CCC[C@@H]2C1 |
| InChI | InChI=1S/C9H13NO/c10-9(11)8-4-6-2-1-3-7(6)5-8/h4,6-7H,1-3,5H2,(H2,10,11)/t6-,7-/m1/s1 |
| InChIKey | IIZPHFCHJBPOKE-RNFRBKRXSA-N |
| XLogP | 1.22 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |