C11H21NO2 — CID 174429341
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;carbamic acid (PubChem CID 174429341) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;carbamic acid.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;carbamic acid |
|---|---|
| PubChem CID | 174429341 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;carbamic acid |
| SMILES | C1CCC2CCCCC2C1.NC(=O)O |
| InChI | InChI=1S/C10H18.CH3NO2/c1-2-6-10-8-4-3-7-9(10)5-1;2-1(3)4/h9-10H,1-8H2;2H2,(H,3,4) |
| InChIKey | AFYLPNGAUZJQEN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |