2-amino-1,3,3a,4,5,6,7,7a-octahydroindene-2-carboxylic acid

C10H17NO2 — CID 83906747

IUPAC2-amino-1,3,3a,4,5,6,7,7a-octahydroindene-2-carboxylic acid
SMILESNC1(C(=O)O)CC2CCCCC2C1
InChIInChI=1S/C10H17NO2/c11-10(9(12)13)5-7-3-1-2-4-8(7)6-10/h7-8H,1-6,11H2,(H,12,13)
InChIKeyOVDPRTRQRNDWFQ-UHFFFAOYSA-N
MW183.25 g/mol
LogP1.37
Rot. Bonds1

About 2-amino-1,3,3a,4,5,6,7,7a-octahydroindene-2-carboxylic acid

2-amino-1,3,3a,4,5,6,7,7a-octahydroindene-2-carboxylic acid (PubChem CID 83906747) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-amino-1,3,3a,4,5,6,7,7a-octahydroindene-2-carboxylic acid.

Molecular Properties

Compound Name2-amino-1,3,3a,4,5,6,7,7a-octahydroindene-2-carboxylic acid
PubChem CID83906747
Molecular FormulaC10H17NO2
Molecular Weight183.25 g/mol
Exact Mass183.13
IUPAC Name2-amino-1,3,3a,4,5,6,7,7a-octahydroindene-2-carboxylic acid
SMILESNC1(C(=O)O)CC2CCCCC2C1
InChIInChI=1S/C10H17NO2/c11-10(9(12)13)5-7-3-1-2-4-8(7)6-10/h7-8H,1-6,11H2,(H,12,13)
InChIKeyOVDPRTRQRNDWFQ-UHFFFAOYSA-N
XLogP1.37
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.25
LogP ≤ 51.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-amino-1,3,3a,4,5,6,7,7a-octahydroindene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-1,3,3a,4,5,6,7,7a-octahydroindene-2-carboxylic acid?
The IUPAC name of 2-amino-1,3,3a,4,5,6,7,7a-octahydroindene-2-carboxylic acid (CID 83906747) is 2-amino-1,3,3a,4,5,6,7,7a-octahydroindene-2-carboxylic acid.
What is the SMILES notation for 2-amino-1,3,3a,4,5,6,7,7a-octahydroindene-2-carboxylic acid?
The canonical SMILES for 2-amino-1,3,3a,4,5,6,7,7a-octahydroindene-2-carboxylic acid is NC1(C(=O)O)CC2CCCCC2C1.
What is the InChIKey of 2-amino-1,3,3a,4,5,6,7,7a-octahydroindene-2-carboxylic acid?
The InChIKey is OVDPRTRQRNDWFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c11-10(9(12)13)5-7-3-1-2-4-8(7)6-10/h7-8H,1-6,11H2,(H,12,13).
What are the key properties of 2-amino-1,3,3a,4,5,6,7,7a-octahydroindene-2-carboxylic acid?
2-amino-1,3,3a,4,5,6,7,7a-octahydroindene-2-carboxylic acid has a molecular weight of 183.25 g/mol, XLogP of 1.37, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,3,3a,4,5,6,7,7a-octahydroindene-2-carboxylic acid is sourced from PubChem (CID 83906747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).