C6H12ClNO3 — CID 105439814
1-amino-3-(hydroxymethyl)cyclobutane-1-carboxylic acid;hydrochloride (PubChem CID 105439814) has the molecular formula C6H12ClNO3 and a molecular weight of 181.62 g/mol. Its IUPAC name is 1-amino-3-(hydroxymethyl)cyclobutane-1-carboxylic acid;hydrochloride.
| Compound Name | 1-amino-3-(hydroxymethyl)cyclobutane-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 105439814 |
| Molecular Formula | C6H12ClNO3 |
| Molecular Weight | 181.62 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 1-amino-3-(hydroxymethyl)cyclobutane-1-carboxylic acid;hydrochloride |
| SMILES | Cl.NC1(C(=O)O)CC(CO)C1 |
| InChI | InChI=1S/C6H11NO3.ClH/c7-6(5(9)10)1-4(2-6)3-8;/h4,8H,1-3,7H2,(H,9,10);1H |
| InChIKey | SBEQUKZKPGRUFS-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.62 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |