cis-(1R,2S)-1-amino-2-bromocyclopropane-1-carboxylic acid

C4H6BrNO2 — CID 10329917

IUPACcis-(1R,2S)-1-amino-2-bromocyclopropane-1-carboxylic acid
SMILESN[C@@]1(C(=O)O)C[C@@H]1Br
InChIInChI=1S/C4H6BrNO2/c5-2-1-4(2,6)3(7)8/h2H,1,6H2,(H,7,8)/t2-,4-/m0/s1
InChIKeyXBVSBWNGOARKPP-OKKQSCSOSA-N
MW180.00 g/mol
LogP-0.06
Rot. Bonds1

About cis-(1R,2S)-1-amino-2-bromocyclopropane-1-carboxylic acid

cis-(1R,2S)-1-amino-2-bromocyclopropane-1-carboxylic acid (PubChem CID 10329917) has the molecular formula C4H6BrNO2 and a molecular weight of 180.00 g/mol. Its IUPAC name is cis-(1R,2S)-1-amino-2-bromocyclopropane-1-carboxylic acid.

Molecular Properties

Compound Namecis-(1R,2S)-1-amino-2-bromocyclopropane-1-carboxylic acid
PubChem CID10329917
Molecular FormulaC4H6BrNO2
Molecular Weight180.00 g/mol
Exact Mass178.96
IUPAC Namecis-(1R,2S)-1-amino-2-bromocyclopropane-1-carboxylic acid
SMILESN[C@@]1(C(=O)O)C[C@@H]1Br
InChIInChI=1S/C4H6BrNO2/c5-2-1-4(2,6)3(7)8/h2H,1,6H2,(H,7,8)/t2-,4-/m0/s1
InChIKeyXBVSBWNGOARKPP-OKKQSCSOSA-N
XLogP-0.06
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.00
LogP ≤ 5-0.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze cis-(1R,2S)-1-amino-2-bromocyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1R,2S)-1-amino-2-bromocyclopropane-1-carboxylic acid?
The IUPAC name of cis-(1R,2S)-1-amino-2-bromocyclopropane-1-carboxylic acid (CID 10329917) is cis-(1R,2S)-1-amino-2-bromocyclopropane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,2S)-1-amino-2-bromocyclopropane-1-carboxylic acid?
The canonical SMILES for cis-(1R,2S)-1-amino-2-bromocyclopropane-1-carboxylic acid is N[C@@]1(C(=O)O)C[C@@H]1Br.
What is the InChIKey of cis-(1R,2S)-1-amino-2-bromocyclopropane-1-carboxylic acid?
The InChIKey is XBVSBWNGOARKPP-OKKQSCSOSA-N. The full InChI is InChI=1S/C4H6BrNO2/c5-2-1-4(2,6)3(7)8/h2H,1,6H2,(H,7,8)/t2-,4-/m0/s1.
What are the key properties of cis-(1R,2S)-1-amino-2-bromocyclopropane-1-carboxylic acid?
cis-(1R,2S)-1-amino-2-bromocyclopropane-1-carboxylic acid has a molecular weight of 180.00 g/mol, XLogP of -0.06, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-1-amino-2-bromocyclopropane-1-carboxylic acid is sourced from PubChem (CID 10329917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).