About 2-aminobicyclo[2.1.1]hexane-2-carboxylic acid;carbon dioxide
2-aminobicyclo[2.1.1]hexane-2-carboxylic acid;carbon dioxide (PubChem CID 169432154) has the molecular formula C8H11NO4
and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-aminobicyclo[2.1.1]hexane-2-carboxylic acid;carbon dioxide.
Molecular Properties
| Compound Name | 2-aminobicyclo[2.1.1]hexane-2-carboxylic acid;carbon dioxide |
| PubChem CID | 169432154 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 2-aminobicyclo[2.1.1]hexane-2-carboxylic acid;carbon dioxide |
| SMILES | NC1(C(=O)O)CC2CC1C2.O=C=O |
| InChI | InChI=1S/C7H11NO2.CO2/c8-7(6(9)10)3-4-1-5(7)2-4;2-1-3/h4-5H,1-3,8H2,(H,9,10); |
| InChIKey | ZXLGQYSEKNETHH-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-aminobicyclo[2.1.1]hexane-2-carboxylic acid;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobicyclo[2.1.1]hexane-2-carboxylic acid;carbon dioxide?
The IUPAC name of 2-aminobicyclo[2.1.1]hexane-2-carboxylic acid;carbon dioxide (CID 169432154) is 2-aminobicyclo[2.1.1]hexane-2-carboxylic acid;carbon dioxide.
What is the SMILES notation for 2-aminobicyclo[2.1.1]hexane-2-carboxylic acid;carbon dioxide?
The canonical SMILES for 2-aminobicyclo[2.1.1]hexane-2-carboxylic acid;carbon dioxide is NC1(C(=O)O)CC2CC1C2.O=C=O.
What is the InChIKey of 2-aminobicyclo[2.1.1]hexane-2-carboxylic acid;carbon dioxide?
The InChIKey is ZXLGQYSEKNETHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2.CO2/c8-7(6(9)10)3-4-1-5(7)2-4;2-1-3/h4-5H,1-3,8H2,(H,9,10);.
What are the key properties of 2-aminobicyclo[2.1.1]hexane-2-carboxylic acid;carbon dioxide?
2-aminobicyclo[2.1.1]hexane-2-carboxylic acid;carbon dioxide has a molecular weight of 185.18 g/mol, XLogP of -0.39, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobicyclo[2.1.1]hexane-2-carboxylic acid;carbon dioxide is sourced from PubChem (CID 169432154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).