C21H31NO2 — CID 18463305
2-(1-adamantyl)-2-aminoadamantane-1-carboxylic acid (PubChem CID 18463305) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 2-(1-adamantyl)-2-aminoadamantane-1-carboxylic acid.
| Compound Name | 2-(1-adamantyl)-2-aminoadamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 18463305 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 2-(1-adamantyl)-2-aminoadamantane-1-carboxylic acid |
| SMILES | NC1(C23CC4CC(CC(C4)C2)C3)C2CC3CC(C2)CC1(C(=O)O)C3 |
| InChI | InChI=1S/C21H31NO2/c22-21(19-7-12-1-13(8-19)3-14(2-12)9-19)17-5-15-4-16(6-17)11-20(21,10-15)18(23)24/h12-17H,1-11,22H2,(H,23,24) |
| InChIKey | QZOVJLACJCODHK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |