C22H26Cl4O3 — CID 98134760
[(5R,7R)-2,2-dichloroadamantane-1-carbonyl] (5R,7R)-2,2-dichloroadamantane-1-carboxylate (PubChem CID 98134760) has the molecular formula C22H26Cl4O3 and a molecular weight of 480.26 g/mol. Its IUPAC name is [(5R,7R)-2,2-dichloroadamantane-1-carbonyl] (5R,7R)-2,2-dichloroadamantane-1-carboxylate.
| Compound Name | [(5R,7R)-2,2-dichloroadamantane-1-carbonyl] (5R,7R)-2,2-dichloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98134760 |
| Molecular Formula | C22H26Cl4O3 |
| Molecular Weight | 480.26 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | [(5R,7R)-2,2-dichloroadamantane-1-carbonyl] (5R,7R)-2,2-dichloroadamantane-1-carboxylate |
| SMILES | O=C(OC(=O)C12C[C@H]3CC(C[C@@H](C3)C1)C2(Cl)Cl)C12C[C@H]3CC(C[C@@H](C3)C1)C2(Cl)Cl |
| InChI | InChI=1S/C22H26Cl4O3/c23-21(24)15-3-11-1-12(4-15)8-19(21,7-11)17(27)29-18(28)20-9-13-2-14(10-20)6-16(5-13)22(20,25)26/h11-16H,1-10H2/t11-,12-,13-,14-,15?,16?,19?,20?/m1/s1 |
| InChIKey | DEZAZONUZUZECG-KHJLJQALSA-N |
| XLogP | 6.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.26 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|