About 1-adamantyl 2-ethyladamantane-2-carboxylate
1-adamantyl 2-ethyladamantane-2-carboxylate (PubChem CID 166021559) has the molecular formula C23H34O2
and a molecular weight of 342.52 g/mol. Its IUPAC name is 1-adamantyl 2-ethyladamantane-2-carboxylate.
Molecular Properties
| Compound Name | 1-adamantyl 2-ethyladamantane-2-carboxylate |
| PubChem CID | 166021559 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 1-adamantyl 2-ethyladamantane-2-carboxylate |
| SMILES | CCC1(C(=O)OC23CC4CC(CC(C4)C2)C3)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C23H34O2/c1-2-23(19-7-14-3-15(9-19)10-20(23)8-14)21(24)25-22-11-16-4-17(12-22)6-18(5-16)13-22/h14-20H,2-13H2,1H3 |
| InChIKey | WQGMNJPRGWBYRY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-adamantyl 2-ethyladamantane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl 2-ethyladamantane-2-carboxylate?
The IUPAC name of 1-adamantyl 2-ethyladamantane-2-carboxylate (CID 166021559) is 1-adamantyl 2-ethyladamantane-2-carboxylate.
What is the SMILES notation for 1-adamantyl 2-ethyladamantane-2-carboxylate?
The canonical SMILES for 1-adamantyl 2-ethyladamantane-2-carboxylate is CCC1(C(=O)OC23CC4CC(CC(C4)C2)C3)C2CC3CC(C2)CC1C3.
What is the InChIKey of 1-adamantyl 2-ethyladamantane-2-carboxylate?
The InChIKey is WQGMNJPRGWBYRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H34O2/c1-2-23(19-7-14-3-15(9-19)10-20(23)8-14)21(24)25-22-11-16-4-17(12-22)6-18(5-16)13-22/h14-20H,2-13H2,1H3.
What are the key properties of 1-adamantyl 2-ethyladamantane-2-carboxylate?
1-adamantyl 2-ethyladamantane-2-carboxylate has a molecular weight of 342.52 g/mol, XLogP of 5.35, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl 2-ethyladamantane-2-carboxylate is sourced from PubChem (CID 166021559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).