C10H21BN2O4 — CID 145395412
(5R)-1-amino-3-(aminomethyl)-5-(2-boronoethyl)cyclohexane-1-carboxylic acid (PubChem CID 145395412) has the molecular formula C10H21BN2O4 and a molecular weight of 244.10 g/mol. Its IUPAC name is (5R)-1-amino-3-(aminomethyl)-5-(2-boronoethyl)cyclohexane-1-carboxylic acid.
| Compound Name | (5R)-1-amino-3-(aminomethyl)-5-(2-boronoethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 145395412 |
| Molecular Formula | C10H21BN2O4 |
| Molecular Weight | 244.10 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (5R)-1-amino-3-(aminomethyl)-5-(2-boronoethyl)cyclohexane-1-carboxylic acid |
| SMILES | NCC1C[C@@H](CCB(O)O)CC(N)(C(=O)O)C1 |
| InChI | InChI=1S/C10H21BN2O4/c12-6-8-3-7(1-2-11(16)17)4-10(13,5-8)9(14)15/h7-8,16-17H,1-6,12-13H2,(H,14,15)/t7-,8?,10?/m1/s1 |
| InChIKey | QDSCKFSNXPAKFN-ZNFPMYQNSA-N |
| XLogP | -0.99 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.10 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|