C15H28BNO4 — CID 153290455
(1R,2S,5R)-1-amino-5-(2-boronoethyl)-2-(cyclopentylmethyl)cyclohexane-1-carboxylic acid (PubChem CID 153290455) has the molecular formula C15H28BNO4 and a molecular weight of 297.20 g/mol. Its IUPAC name is (1R,2S,5R)-1-amino-5-(2-boronoethyl)-2-(cyclopentylmethyl)cyclohexane-1-carboxylic acid.
| Compound Name | (1R,2S,5R)-1-amino-5-(2-boronoethyl)-2-(cyclopentylmethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 153290455 |
| Molecular Formula | C15H28BNO4 |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (1R,2S,5R)-1-amino-5-(2-boronoethyl)-2-(cyclopentylmethyl)cyclohexane-1-carboxylic acid |
| SMILES | N[C@]1(C(=O)O)C[C@H](CCB(O)O)CC[C@H]1CC1CCCC1 |
| InChI | InChI=1S/C15H28BNO4/c17-15(14(18)19)10-12(7-8-16(20)21)5-6-13(15)9-11-3-1-2-4-11/h11-13,20-21H,1-10,17H2,(H,18,19)/t12-,13-,15+/m0/s1 |
| InChIKey | OWFLXWKKDFLPDY-KCQAQPDRSA-N |
| XLogP | 1.63 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|