C11H25BN2O4 — CID 145395382
1,2-diamino-5-(2-boronoethyl)cyclohexane-1-carboxylic acid;ethane (PubChem CID 145395382) has the molecular formula C11H25BN2O4 and a molecular weight of 260.14 g/mol. Its IUPAC name is 1,2-diamino-5-(2-boronoethyl)cyclohexane-1-carboxylic acid;ethane.
| Compound Name | 1,2-diamino-5-(2-boronoethyl)cyclohexane-1-carboxylic acid;ethane |
|---|---|
| PubChem CID | 145395382 |
| Molecular Formula | C11H25BN2O4 |
| Molecular Weight | 260.14 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 1,2-diamino-5-(2-boronoethyl)cyclohexane-1-carboxylic acid;ethane |
| SMILES | CC.NC1CCC(CCB(O)O)CC1(N)C(=O)O |
| InChI | InChI=1S/C9H19BN2O4.C2H6/c11-7-2-1-6(3-4-10(15)16)5-9(7,12)8(13)14;1-2/h6-7,15-16H,1-5,11-12H2,(H,13,14);1-2H3 |
| InChIKey | DMXXVDFEKXCTLT-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.14 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|