C11H22BNO4 — CID 165036434
(1R,2S,5R)-1-amino-5-(2-boronoethyl)-2-ethylcyclohexane-1-carboxylic acid (PubChem CID 165036434) has the molecular formula C11H22BNO4 and a molecular weight of 243.11 g/mol. Its IUPAC name is (1R,2S,5R)-1-amino-5-(2-boronoethyl)-2-ethylcyclohexane-1-carboxylic acid.
| Compound Name | (1R,2S,5R)-1-amino-5-(2-boronoethyl)-2-ethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 165036434 |
| Molecular Formula | C11H22BNO4 |
| Molecular Weight | 243.11 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (1R,2S,5R)-1-amino-5-(2-boronoethyl)-2-ethylcyclohexane-1-carboxylic acid |
| SMILES | CC[C@H]1CC[C@@H](CCB(O)O)C[C@]1(N)C(=O)O |
| InChI | InChI=1S/C11H22BNO4/c1-2-9-4-3-8(5-6-12(16)17)7-11(9,13)10(14)15/h8-9,16-17H,2-7,13H2,1H3,(H,14,15)/t8-,9-,11+/m0/s1 |
| InChIKey | NLENMEPWFZDOHD-ATZCPNFKSA-N |
| XLogP | 0.46 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.11 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|