C24H33BN2O4 — CID 164549460
(1R,2R,5R)-1-amino-5-(2-boronoethyl)-2-[(dibenzylamino)methyl]cyclohexane-1-carboxylic acid (PubChem CID 164549460) has the molecular formula C24H33BN2O4 and a molecular weight of 424.35 g/mol. Its IUPAC name is (1R,2R,5R)-1-amino-5-(2-boronoethyl)-2-[(dibenzylamino)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | (1R,2R,5R)-1-amino-5-(2-boronoethyl)-2-[(dibenzylamino)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 164549460 |
| Molecular Formula | C24H33BN2O4 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | (1R,2R,5R)-1-amino-5-(2-boronoethyl)-2-[(dibenzylamino)methyl]cyclohexane-1-carboxylic acid |
| SMILES | N[C@]1(C(=O)O)C[C@H](CCB(O)O)CC[C@@H]1CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H33BN2O4/c26-24(23(28)29)15-19(13-14-25(30)31)11-12-22(24)18-27(16-20-7-3-1-4-8-20)17-21-9-5-2-6-10-21/h1-10,19,22,30-31H,11-18,26H2,(H,28,29)/t19-,22+,24+/m0/s1 |
| InChIKey | SLDAZKIUDUVVQP-BPUDTRNYSA-N |
| XLogP | 2.75 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|