About N,N-dibenzyl-1-[(1R)-2,2-dibromocyclopropyl]methanamine
N,N-dibenzyl-1-[(1R)-2,2-dibromocyclopropyl]methanamine (PubChem CID 10938445) has the molecular formula C18H19Br2N
and a molecular weight of 409.17 g/mol. Its IUPAC name is N,N-dibenzyl-1-[(1R)-2,2-dibromocyclopropyl]methanamine.
Molecular Properties
| Compound Name | N,N-dibenzyl-1-[(1R)-2,2-dibromocyclopropyl]methanamine |
| PubChem CID | 10938445 |
| Molecular Formula | C18H19Br2N |
| Molecular Weight | 409.17 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | N,N-dibenzyl-1-[(1R)-2,2-dibromocyclopropyl]methanamine |
| SMILES | BrC1(Br)C[C@@H]1CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H19Br2N/c19-18(20)11-17(18)14-21(12-15-7-3-1-4-8-15)13-16-9-5-2-6-10-16/h1-10,17H,11-14H2/t17-/m1/s1 |
| InChIKey | HKJHWANEOWSXJR-QGZVFWFLSA-N |
| XLogP | 5.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.17 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibenzyl-1-[(1R)-2,2-dibromocyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibenzyl-1-[(1R)-2,2-dibromocyclopropyl]methanamine?
The IUPAC name of N,N-dibenzyl-1-[(1R)-2,2-dibromocyclopropyl]methanamine (CID 10938445) is N,N-dibenzyl-1-[(1R)-2,2-dibromocyclopropyl]methanamine.
What is the SMILES notation for N,N-dibenzyl-1-[(1R)-2,2-dibromocyclopropyl]methanamine?
The canonical SMILES for N,N-dibenzyl-1-[(1R)-2,2-dibromocyclopropyl]methanamine is BrC1(Br)C[C@@H]1CN(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of N,N-dibenzyl-1-[(1R)-2,2-dibromocyclopropyl]methanamine?
The InChIKey is HKJHWANEOWSXJR-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H19Br2N/c19-18(20)11-17(18)14-21(12-15-7-3-1-4-8-15)13-16-9-5-2-6-10-16/h1-10,17H,11-14H2/t17-/m1/s1.
What are the key properties of N,N-dibenzyl-1-[(1R)-2,2-dibromocyclopropyl]methanamine?
N,N-dibenzyl-1-[(1R)-2,2-dibromocyclopropyl]methanamine has a molecular weight of 409.17 g/mol, XLogP of 5.19, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibenzyl-1-[(1R)-2,2-dibromocyclopropyl]methanamine is sourced from PubChem (CID 10938445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).