C14H27BN2O4 — CID 152876993
cis-(1R,5R)-1-amino-5-(2-boronoethyl)-2-(pyrrolidin-1-ylmethyl)cyclohexane-1-carboxylic acid (PubChem CID 152876993) has the molecular formula C14H27BN2O4 and a molecular weight of 298.19 g/mol. Its IUPAC name is cis-(1R,5R)-1-amino-5-(2-boronoethyl)-2-(pyrrolidin-1-ylmethyl)cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1R,5R)-1-amino-5-(2-boronoethyl)-2-(pyrrolidin-1-ylmethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 152876993 |
| Molecular Formula | C14H27BN2O4 |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | cis-(1R,5R)-1-amino-5-(2-boronoethyl)-2-(pyrrolidin-1-ylmethyl)cyclohexane-1-carboxylic acid |
| SMILES | N[C@]1(C(=O)O)C[C@H](CCB(O)O)CCC1CN1CCCC1 |
| InChI | InChI=1S/C14H27BN2O4/c16-14(13(18)19)9-11(5-6-15(20)21)3-4-12(14)10-17-7-1-2-8-17/h11-12,20-21H,1-10,16H2,(H,18,19)/t11-,12?,14+/m0/s1 |
| InChIKey | UAPRSXRXODTICL-HFUMIRBISA-N |
| XLogP | 0.14 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|