C11H24BCl2N3O5S — CID 153436763
(3R,5S)-3-amino-1-[(2R)-2-amino-3-sulfanylpropanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid;dihydrochloride (PubChem CID 153436763) has the molecular formula C11H24BCl2N3O5S and a molecular weight of 392.11 g/mol. Its IUPAC name is (3R,5S)-3-amino-1-[(2R)-2-amino-3-sulfanylpropanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid;dihydrochloride.
| Compound Name | (3R,5S)-3-amino-1-[(2R)-2-amino-3-sulfanylpropanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid;dihydrochloride |
|---|---|
| PubChem CID | 153436763 |
| Molecular Formula | C11H24BCl2N3O5S |
| Molecular Weight | 392.11 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | (3R,5S)-3-amino-1-[(2R)-2-amino-3-sulfanylpropanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H](CS)C(=O)N1C[C@@H](CCB(O)O)C[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C11H22BN3O5S.2ClH/c13-8(5-21)9(16)15-4-7(1-2-12(19)20)3-11(14,6-15)10(17)18;;/h7-8,19-21H,1-6,13-14H2,(H,17,18);2*1H/t7-,8-,11+;;/m0../s1 |
| InChIKey | NZBNPQPCLJYKQV-AVTLXFHMSA-N |
| XLogP | -1.42 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.11 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|