C12H24BN3O5S — CID 174008999
[(3S)-3-amino-1-[(3S)-3-amino-2-oxobutyl]-5-(2-boronoethyl)piperidin-3-yl]sulfanylformic acid (PubChem CID 174008999) has the molecular formula C12H24BN3O5S and a molecular weight of 333.22 g/mol. Its IUPAC name is [(3S)-3-amino-1-[(3S)-3-amino-2-oxobutyl]-5-(2-boronoethyl)piperidin-3-yl]sulfanylformic acid.
| Compound Name | [(3S)-3-amino-1-[(3S)-3-amino-2-oxobutyl]-5-(2-boronoethyl)piperidin-3-yl]sulfanylformic acid |
|---|---|
| PubChem CID | 174008999 |
| Molecular Formula | C12H24BN3O5S |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | [(3S)-3-amino-1-[(3S)-3-amino-2-oxobutyl]-5-(2-boronoethyl)piperidin-3-yl]sulfanylformic acid |
| SMILES | C[C@H](N)C(=O)CN1CC(CCB(O)O)C[C@](N)(SC(=O)O)C1 |
| InChI | InChI=1S/C12H24BN3O5S/c1-8(14)10(17)6-16-5-9(2-3-13(20)21)4-12(15,7-16)22-11(18)19/h8-9,20-21H,2-7,14-15H2,1H3,(H,18,19)/t8-,9?,12-/m0/s1 |
| InChIKey | GOSPQTOFHBVDDV-OYGLUPDLSA-N |
| XLogP | -0.85 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|