C12H23BN2O6S — CID 153378417
5-amino-4-(3-boronopropyl)-2-methylsulfonyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid (PubChem CID 153378417) has the molecular formula C12H23BN2O6S and a molecular weight of 334.20 g/mol. Its IUPAC name is 5-amino-4-(3-boronopropyl)-2-methylsulfonyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid.
| Compound Name | 5-amino-4-(3-boronopropyl)-2-methylsulfonyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 153378417 |
| Molecular Formula | C12H23BN2O6S |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 5-amino-4-(3-boronopropyl)-2-methylsulfonyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid |
| SMILES | CS(=O)(=O)N1CC2CC(N)(C(=O)O)C(CCCB(O)O)C2C1 |
| InChI | InChI=1S/C12H23BN2O6S/c1-22(20,21)15-6-8-5-12(14,11(16)17)10(9(8)7-15)3-2-4-13(18)19/h8-10,18-19H,2-7,14H2,1H3,(H,16,17) |
| InChIKey | IFWUIWDEJLQIRD-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|