C13H24BN3O5 — CID 162445621
(3aR,6aR)-5-amino-2-(2-amino-2-oxoethyl)-4-(3-boronopropyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid (PubChem CID 162445621) has the molecular formula C13H24BN3O5 and a molecular weight of 313.16 g/mol. Its IUPAC name is (3aR,6aR)-5-amino-2-(2-amino-2-oxoethyl)-4-(3-boronopropyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid.
| Compound Name | (3aR,6aR)-5-amino-2-(2-amino-2-oxoethyl)-4-(3-boronopropyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 162445621 |
| Molecular Formula | C13H24BN3O5 |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (3aR,6aR)-5-amino-2-(2-amino-2-oxoethyl)-4-(3-boronopropyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid |
| SMILES | NC(=O)CN1C[C@@H]2CC(N)(C(=O)O)C(CCCB(O)O)[C@@H]2C1 |
| InChI | InChI=1S/C13H24BN3O5/c15-11(18)7-17-5-8-4-13(16,12(19)20)10(9(8)6-17)2-1-3-14(21)22/h8-10,21-22H,1-7,16H2,(H2,15,18)(H,19,20)/t8-,9+,10?,13?/m0/s1 |
| InChIKey | JFAIZGXLGLUYDM-DFWJVEDMSA-N |
| XLogP | -1.93 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|