C11H22BN3O6 — CID 148568500
(3R,5S)-3-amino-1-[(2S)-2-amino-3-hydroxypropanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid (PubChem CID 148568500) has the molecular formula C11H22BN3O6 and a molecular weight of 303.12 g/mol. Its IUPAC name is (3R,5S)-3-amino-1-[(2S)-2-amino-3-hydroxypropanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,5S)-3-amino-1-[(2S)-2-amino-3-hydroxypropanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 148568500 |
| Molecular Formula | C11H22BN3O6 |
| Molecular Weight | 303.12 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (3R,5S)-3-amino-1-[(2S)-2-amino-3-hydroxypropanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid |
| SMILES | N[C@@H](CO)C(=O)N1C[C@@H](CCB(O)O)C[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C11H22BN3O6/c13-8(5-16)9(17)15-4-7(1-2-12(20)21)3-11(14,6-15)10(18)19/h7-8,16,20-21H,1-6,13-14H2,(H,18,19)/t7-,8-,11+/m0/s1 |
| InChIKey | MWKKSCAJOSODDD-DKCNOQQISA-N |
| XLogP | -3.20 |
| TPSA | 170.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.12 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|