C14H31BN4O5 — CID 142349396
3-[(4R)-4-amino-1-[(2S)-2,6-diaminohexanoyl]-4-(dihydroxymethyl)pyrrolidin-3-yl]propylboronic acid (PubChem CID 142349396) has the molecular formula C14H31BN4O5 and a molecular weight of 346.24 g/mol. Its IUPAC name is 3-[(4R)-4-amino-1-[(2S)-2,6-diaminohexanoyl]-4-(dihydroxymethyl)pyrrolidin-3-yl]propylboronic acid.
| Compound Name | 3-[(4R)-4-amino-1-[(2S)-2,6-diaminohexanoyl]-4-(dihydroxymethyl)pyrrolidin-3-yl]propylboronic acid |
|---|---|
| PubChem CID | 142349396 |
| Molecular Formula | C14H31BN4O5 |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 3-[(4R)-4-amino-1-[(2S)-2,6-diaminohexanoyl]-4-(dihydroxymethyl)pyrrolidin-3-yl]propylboronic acid |
| SMILES | NCCCC[C@H](N)C(=O)N1CC(CCCB(O)O)[C@](N)(C(O)O)C1 |
| InChI | InChI=1S/C14H31BN4O5/c16-7-2-1-5-11(17)12(20)19-8-10(4-3-6-15(23)24)14(18,9-19)13(21)22/h10-11,13,21-24H,1-9,16-18H2/t10?,11-,14-/m0/s1 |
| InChIKey | SWKUZGGPKOSTCK-UCOFZHQHSA-N |
| XLogP | -2.84 |
| TPSA | 179.29 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|