C9H21BCl2N2O4 — CID 162327453
3-amino-5-(2-boronoethyl)-1-methylpiperidine-3-carboxylic acid;dihydrochloride (PubChem CID 162327453) has the molecular formula C9H21BCl2N2O4 and a molecular weight of 303.00 g/mol. Its IUPAC name is 3-amino-5-(2-boronoethyl)-1-methylpiperidine-3-carboxylic acid;dihydrochloride.
| Compound Name | 3-amino-5-(2-boronoethyl)-1-methylpiperidine-3-carboxylic acid;dihydrochloride |
|---|---|
| PubChem CID | 162327453 |
| Molecular Formula | C9H21BCl2N2O4 |
| Molecular Weight | 303.00 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 3-amino-5-(2-boronoethyl)-1-methylpiperidine-3-carboxylic acid;dihydrochloride |
| SMILES | CN1CC(CCB(O)O)CC(N)(C(=O)O)C1.Cl.Cl |
| InChI | InChI=1S/C9H19BN2O4.2ClH/c1-12-5-7(2-3-10(15)16)4-9(11,6-12)8(13)14;;/h7,15-16H,2-6,11H2,1H3,(H,13,14);2*1H |
| InChIKey | FFLUQOYUARFXDO-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.00 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|