C29H53BN4O11 — CID 153436760
(3R,5S)-1-[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-5-(2-boronoethyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylic acid (PubChem CID 153436760) has the molecular formula C29H53BN4O11 and a molecular weight of 644.57 g/mol. Its IUPAC name is (3R,5S)-1-[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-5-(2-boronoethyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylic acid.
| Compound Name | (3R,5S)-1-[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-5-(2-boronoethyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 153436760 |
| Molecular Formula | C29H53BN4O11 |
| Molecular Weight | 644.57 g/mol |
| Exact Mass | 644.38 |
| IUPAC Name | (3R,5S)-1-[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-5-(2-boronoethyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[C@@H](CCB(O)O)C[C@](NC(=O)OC(C)(C)C)(C(=O)O)C1 |
| InChI | InChI=1S/C29H53BN4O11/c1-26(2,3)43-23(38)31-15-11-10-12-20(32-24(39)44-27(4,5)6)21(35)34-17-19(13-14-30(41)42)16-29(18-34,22(36)37)33-25(40)45-28(7,8)9/h19-20,41-42H,10-18H2,1-9H3,(H,31,38)(H,32,39)(H,33,40)(H,36,37)/t19-,20-,29+/m0/s1 |
| InChIKey | HQPCFHLAGUISTO-QWQFASRJSA-N |
| XLogP | 2.63 |
| TPSA | 213.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.57 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|