C10H12N2O3 — CID 123783966
5-acetylcyclohexa-1,3-diene-1,3-dicarboxamide (PubChem CID 123783966) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 5-acetylcyclohexa-1,3-diene-1,3-dicarboxamide.
| Compound Name | 5-acetylcyclohexa-1,3-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 123783966 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 5-acetylcyclohexa-1,3-diene-1,3-dicarboxamide |
| SMILES | CC(=O)C1C=C(C(N)=O)C=C(C(N)=O)C1 |
| InChI | InChI=1S/C10H12N2O3/c1-5(13)6-2-7(9(11)14)4-8(3-6)10(12)15/h2,4,6H,3H2,1H3,(H2,11,14)(H2,12,15) |
| InChIKey | MKUYCBMSYFCELS-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |