C14H16O4 — CID 163919126
1-(3,4,6-triacetylcyclohexa-2,4-dien-1-yl)ethanone (PubChem CID 163919126) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-(3,4,6-triacetylcyclohexa-2,4-dien-1-yl)ethanone.
| Compound Name | 1-(3,4,6-triacetylcyclohexa-2,4-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 163919126 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-(3,4,6-triacetylcyclohexa-2,4-dien-1-yl)ethanone |
| SMILES | CC(=O)C1=CC(C(C)=O)C(C(C)=O)C=C1C(C)=O |
| InChI | InChI=1S/C14H16O4/c1-7(15)11-5-13(9(3)17)14(10(4)18)6-12(11)8(2)16/h5-6,11-12H,1-4H3 |
| InChIKey | QYWIRWXTZFPDGC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |