C8H8F2O — CID 163586256
1-(3,6-difluorocyclohexa-2,4-dien-1-yl)ethanone (PubChem CID 163586256) has the molecular formula C8H8F2O and a molecular weight of 158.15 g/mol. Its IUPAC name is 1-(3,6-difluorocyclohexa-2,4-dien-1-yl)ethanone.
| Compound Name | 1-(3,6-difluorocyclohexa-2,4-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 163586256 |
| Molecular Formula | C8H8F2O |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 1-(3,6-difluorocyclohexa-2,4-dien-1-yl)ethanone |
| SMILES | CC(=O)C1C=C(F)C=CC1F |
| InChI | InChI=1S/C8H8F2O/c1-5(11)7-4-6(9)2-3-8(7)10/h2-4,7-8H,1H3 |
| InChIKey | GLSSIKBHAZTLHY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |