About ethane;2-fluoro-5,6-dimethylcyclohexa-1,3-diene
ethane;2-fluoro-5,6-dimethylcyclohexa-1,3-diene (PubChem CID 144993516) has the molecular formula C10H17F
and a molecular weight of 156.24 g/mol. Its IUPAC name is ethane;2-fluoro-5,6-dimethylcyclohexa-1,3-diene.
Analyze ethane;2-fluoro-5,6-dimethylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-fluoro-5,6-dimethylcyclohexa-1,3-diene?
The IUPAC name of ethane;2-fluoro-5,6-dimethylcyclohexa-1,3-diene (CID 144993516) is ethane;2-fluoro-5,6-dimethylcyclohexa-1,3-diene.
What is the SMILES notation for ethane;2-fluoro-5,6-dimethylcyclohexa-1,3-diene?
The canonical SMILES for ethane;2-fluoro-5,6-dimethylcyclohexa-1,3-diene is CC.CC1C=CC(F)=CC1C.
What is the InChIKey of ethane;2-fluoro-5,6-dimethylcyclohexa-1,3-diene?
The InChIKey is NRTGWWJSIIRGLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F.C2H6/c1-6-3-4-8(9)5-7(6)2;1-2/h3-7H,1-2H3;1-2H3.
What are the key properties of ethane;2-fluoro-5,6-dimethylcyclohexa-1,3-diene?
ethane;2-fluoro-5,6-dimethylcyclohexa-1,3-diene has a molecular weight of 156.24 g/mol, XLogP of 3.71, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-fluoro-5,6-dimethylcyclohexa-1,3-diene is sourced from PubChem (CID 144993516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).