C7H10FI — CID 143792431
2-fluoro-5-methylcyclohexa-1,3-diene;hydroiodide (PubChem CID 143792431) has the molecular formula C7H10FI and a molecular weight of 240.06 g/mol. Its IUPAC name is 2-fluoro-5-methylcyclohexa-1,3-diene;hydroiodide.
| Compound Name | 2-fluoro-5-methylcyclohexa-1,3-diene;hydroiodide |
|---|---|
| PubChem CID | 143792431 |
| Molecular Formula | C7H10FI |
| Molecular Weight | 240.06 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 2-fluoro-5-methylcyclohexa-1,3-diene;hydroiodide |
| SMILES | CC1C=CC(F)=CC1.I |
| InChI | InChI=1S/C7H9F.HI/c1-6-2-4-7(8)5-3-6;/h2,4-6H,3H2,1H3;1H |
| InChIKey | IAFIEXVTZSEWDM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.06 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|