C7H11NO — CID 145306811
N-(4-methylcyclohexa-1,5-dien-1-yl)hydroxylamine (PubChem CID 145306811) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is N-(4-methylcyclohexa-1,5-dien-1-yl)hydroxylamine.
| Compound Name | N-(4-methylcyclohexa-1,5-dien-1-yl)hydroxylamine |
|---|---|
| PubChem CID | 145306811 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | N-(4-methylcyclohexa-1,5-dien-1-yl)hydroxylamine |
| SMILES | CC1C=CC(NO)=CC1 |
| InChI | InChI=1S/C7H11NO/c1-6-2-4-7(8-9)5-3-6/h2,4-6,8-9H,3H2,1H3 |
| InChIKey | WETGIVHLWZHDCU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|