C10H15NOS — CID 118282020
O-(4-methylcyclohexa-1,5-dien-1-yl) N,N-dimethylcarbamothioate (PubChem CID 118282020) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is O-(4-methylcyclohexa-1,5-dien-1-yl) N,N-dimethylcarbamothioate.
| Compound Name | O-(4-methylcyclohexa-1,5-dien-1-yl) N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 118282020 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | O-(4-methylcyclohexa-1,5-dien-1-yl) N,N-dimethylcarbamothioate |
| SMILES | CC1C=CC(OC(=S)N(C)C)=CC1 |
| InChI | InChI=1S/C10H15NOS/c1-8-4-6-9(7-5-8)12-10(13)11(2)3/h4,6-8H,5H2,1-3H3 |
| InChIKey | SWWGWMUFQRRMGX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|