C9H11N — CID 163641813
2-(4-methylcyclohexa-1,5-dien-1-yl)-2H-azirine (PubChem CID 163641813) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is 2-(4-methylcyclohexa-1,5-dien-1-yl)-2H-azirine.
| Compound Name | 2-(4-methylcyclohexa-1,5-dien-1-yl)-2H-azirine |
|---|---|
| PubChem CID | 163641813 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 2-(4-methylcyclohexa-1,5-dien-1-yl)-2H-azirine |
| SMILES | CC1C=CC(C2C=N2)=CC1 |
| InChI | InChI=1S/C9H11N/c1-7-2-4-8(5-3-7)9-6-10-9/h2,4-7,9H,3H2,1H3 |
| InChIKey | IEWMUNZBGGFJLC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |