C15H18 — CID 154542947
1-(4-methylcyclohexa-1,5-dien-1-yl)ethylbenzene (PubChem CID 154542947) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-(4-methylcyclohexa-1,5-dien-1-yl)ethylbenzene.
| Compound Name | 1-(4-methylcyclohexa-1,5-dien-1-yl)ethylbenzene |
|---|---|
| PubChem CID | 154542947 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-(4-methylcyclohexa-1,5-dien-1-yl)ethylbenzene |
| SMILES | CC1C=CC(C(C)c2ccccc2)=CC1 |
| InChI | InChI=1S/C15H18/c1-12-8-10-15(11-9-12)13(2)14-6-4-3-5-7-14/h3-8,10-13H,9H2,1-2H3 |
| InChIKey | VHZSFNOBAGNYTJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |