C15H16 — CID 123815989
3-(1-phenylethyl)cyclohepta-1,3,5-triene (PubChem CID 123815989) has the molecular formula C15H16 and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-(1-phenylethyl)cyclohepta-1,3,5-triene.
| Compound Name | 3-(1-phenylethyl)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 123815989 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 3-(1-phenylethyl)cyclohepta-1,3,5-triene |
| SMILES | CC(C1=CC=CCC=C1)c1ccccc1 |
| InChI | InChI=1S/C15H16/c1-13(15-11-7-4-8-12-15)14-9-5-2-3-6-10-14/h2,4-13H,3H2,1H3 |
| InChIKey | HDZXNNZHPRUYQK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |