C15H18N+ — CID 90938590
cyclohepta-1,3,6-trien-1-yl-dimethyl-phenylazanium (PubChem CID 90938590) has the molecular formula C15H18N+ and a molecular weight of 212.32 g/mol. Its IUPAC name is cyclohepta-1,3,6-trien-1-yl-dimethyl-phenylazanium.
| Compound Name | cyclohepta-1,3,6-trien-1-yl-dimethyl-phenylazanium |
|---|---|
| PubChem CID | 90938590 |
| Molecular Formula | C15H18N+ |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | cyclohepta-1,3,6-trien-1-yl-dimethyl-phenylazanium |
| SMILES | C[N+](C)(C1=CC=CCC=C1)c1ccccc1 |
| InChI | InChI=1S/C15H18N/c1-16(2,15-12-8-5-9-13-15)14-10-6-3-4-7-11-14/h3,5-13H,4H2,1-2H3/q+1 |
| InChIKey | SZUBUXOEDMQGEQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|