About ethane;3-(3-methyl-5-phenylphenyl)cyclohepta-1,3,5-triene
ethane;3-(3-methyl-5-phenylphenyl)cyclohepta-1,3,5-triene (PubChem CID 145328002) has the molecular formula C22H24
and a molecular weight of 288.43 g/mol. Its IUPAC name is ethane;3-(3-methyl-5-phenylphenyl)cyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | ethane;3-(3-methyl-5-phenylphenyl)cyclohepta-1,3,5-triene |
| PubChem CID | 145328002 |
| Molecular Formula | C22H24 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | ethane;3-(3-methyl-5-phenylphenyl)cyclohepta-1,3,5-triene |
| SMILES | CC.Cc1cc(C2=CC=CCC=C2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H18.C2H6/c1-16-13-19(17-9-5-2-3-6-10-17)15-20(14-16)18-11-7-4-8-12-18;1-2/h2,4-15H,3H2,1H3;1-2H3 |
| InChIKey | WVOWQRNHWDKSLV-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;3-(3-methyl-5-phenylphenyl)cyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(3-methyl-5-phenylphenyl)cyclohepta-1,3,5-triene?
The IUPAC name of ethane;3-(3-methyl-5-phenylphenyl)cyclohepta-1,3,5-triene (CID 145328002) is ethane;3-(3-methyl-5-phenylphenyl)cyclohepta-1,3,5-triene.
What is the SMILES notation for ethane;3-(3-methyl-5-phenylphenyl)cyclohepta-1,3,5-triene?
The canonical SMILES for ethane;3-(3-methyl-5-phenylphenyl)cyclohepta-1,3,5-triene is CC.Cc1cc(C2=CC=CCC=C2)cc(-c2ccccc2)c1.
What is the InChIKey of ethane;3-(3-methyl-5-phenylphenyl)cyclohepta-1,3,5-triene?
The InChIKey is WVOWQRNHWDKSLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18.C2H6/c1-16-13-19(17-9-5-2-3-6-10-17)15-20(14-16)18-11-7-4-8-12-18;1-2/h2,4-15H,3H2,1H3;1-2H3.
What are the key properties of ethane;3-(3-methyl-5-phenylphenyl)cyclohepta-1,3,5-triene?
ethane;3-(3-methyl-5-phenylphenyl)cyclohepta-1,3,5-triene has a molecular weight of 288.43 g/mol, XLogP of 6.59, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(3-methyl-5-phenylphenyl)cyclohepta-1,3,5-triene is sourced from PubChem (CID 145328002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).