C26H23N — CID 146580162
4-(3,5-diphenylphenyl)-1-methylcyclohepta-2,4,6-trien-1-amine (PubChem CID 146580162) has the molecular formula C26H23N and a molecular weight of 349.48 g/mol. Its IUPAC name is 4-(3,5-diphenylphenyl)-1-methylcyclohepta-2,4,6-trien-1-amine.
| Compound Name | 4-(3,5-diphenylphenyl)-1-methylcyclohepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 146580162 |
| Molecular Formula | C26H23N |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 4-(3,5-diphenylphenyl)-1-methylcyclohepta-2,4,6-trien-1-amine |
| SMILES | CC1(N)C=CC=C(c2cc(-c3ccccc3)cc(-c3ccccc3)c2)C=C1 |
| InChI | InChI=1S/C26H23N/c1-26(27)15-8-13-22(14-16-26)25-18-23(20-9-4-2-5-10-20)17-24(19-25)21-11-6-3-7-12-21/h2-19H,27H2,1H3 |
| InChIKey | NGCMJIIQAPIRHL-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |